16
Cat No. | Product Name | Synonyms | Targets |
---|---|---|---|
T18616 | NH2-C2-NH-Boc | PROTAC Linker 22 | Others , PROTAC Linker |
NH2-C2-NH-Boc (PROTAC Linker 22) (PROTAC Linker 22) is a alkyl chain-based PROTAC linker. NH2-C2-NH-Boc can be used in the synthesis of PROTACs. | |||
T16520 | Ph-Bis(C1-N-(C2-NH-Boc)2) | Others | |
Ph-Bis(C1-N-(C2-NH-Boc)2) is a versatile alkyl chain-derived linker employed in the synthesis of PROTACs[1]. | |||
T39524 | Thalidomide-NH-PEG2-C2-NH-Boc | Thalidomide-NH-PEG2-C2-NH-Boc | |
Thalidomide-NH-PEG2-C2-NH-Boc, a synthesized E3 ligase ligand-linker conjugate, combines the cereblon-targeting Thalidomide ligand with a PEG linker for the synthesis of dBRD9 (compound 6). This selective BRD9 probe PROT... | |||
T16296 | NH-bis(C2-PEG2-NH-Boc) | Others | |
NH-bis(C2-PEG2-NH-Boc) is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules. This linker enables selective protein degradation by leveraging the ubiquitin-proteasome s... | |||
T17745 | DBCO-C2-PEG4-NH-Boc | Others | |
DBCO-C2-PEG4-NH-Boc is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules. This linker enables selective protein degradation by leveraging the ubiquitin-proteasome syst... | |||
T16299 | NH-bis(PEG2-C2-Boc) | Others | |
NH-bis(PEG2-C2-Boc) is an alkyl/ether-based linker, utilized for the synthesis of PROTACs[1]. | |||
T14816 | Bromoacetamido-C2-PEG2-NH-Boc | Others | |
Bromoacetamido-C2-PEG2-NH-Boc is a polyethylene glycol (PEG)-based linker with a bromoacetamido functional group and a tert-butoxycarbonyl (Boc) protecting group. It serves as an integral component in the synthesis of pr... | |||
T14736 | Boc-NH-PEG2-C2-NHS ester | Others | |
Boc-NH-PEG2-C2-NHS ester is an alkyl/ether-derived PROTAC linker employed for the synthesis of PROTACs[1]. | |||
T16661 | NH2-PEG5-C2-NH-Boc | PROTAC Linker 17 | Others |
NH2-PEG5-C2-NH-Boc (PROTAC Linker 17) is a PEG-based compound utilized as a linker in the synthesis of PROTACs[1]. | |||
T16659 | Boc-NH-PEG2-C2-NH2 | PROTAC Linker 13 | Others |
Boc-NH-PEG2-C2-NH2 (PROTAC Linker 13) is a PEG-based linker utilized for the synthesis of PROTACs. This chemical compound plays a crucial role in connecting the targeted protein and the E3 ubiquitin ligase for selective ... | |||
T14163 | Ald-Ph-amido-C2-PEG3-NH-Boc | Others | |
Ald-Ph-amido-C2-PEG3-NH-Boc is a polyethylene glycol (PEG)-based bifunctional linker utilized for the synthesis of Proteolysis Targeting Chimeras (PROTACs)[1]. | |||
T16311 | NH2-PEG2-C2-Boc | Others | |
NH2-PEG2-C2-Boc is a polyethylene glycol (PEG)-based PROTAC linker utilized for synthesizing PROTACs[1]. It serves as a non-cleavable 2-unit PEG linker for antibody-drug conjugates (ADCs) in their synthesis[2]. | |||
T18484 | NH2-C2-amido-C2-Boc | Others | |
NH2-C2-amido-C2-Boc is an alkyl/ether-based PROTAC linker employed in the synthesis of various PROTACs, including the PROTAC CDK2/9 Degrader-1[1]. NH2-C5-NH-Boc can also serve as a suitable precursor for the synthesis of... | |||
T18623 | Boc-NH-PEG2-C2-amido-C4-acid | PROTAC Linker 30 | Others |
Boc-NH-PEG2-C2-amido-C4-acid (PROTAC Linker 30) is a polyethylene glycol (PEG)-based linker utilized for the synthesis of Proteolysis Targeting Chimeras (PROTACs)[1]. | |||
T20098 | NH2-PEG3-C2-Boc | Amino-PEG3-t-butyl ester | |
Amino-PEG3-t-butyl ester is a PEG derivative containing an amino group with the t-butyl protected carboxyl group. The t-butyl protected carboxyl group can be deprotected under acidic conditions. | |||
T17906 | Pomalidomide-amido-C4-amido-PEG2-C2-NH-Boc | E3 Ligase Ligand-Linker Conjugates 53,Cereblon Ligand-Linker Conjugates 20 | Others |
Pomalidomide-amido-C4-amido-PEG2-C2-NH-Boc is a novel synthesized conjugate compound functioning as an E3 ligase ligand-linker in PROTAC technology. This compound incorporates a Pomalidomide-derived cereblon ligand, whic... |