Shopping Cart
Remove All
Your shopping cart is currently empty
Azure B (Azure B chloride) is a cationic dye and the major metabolite of Methylene blue. Azure B is a selective, and reversible inhibitor of MAO-A (IC50s: 11 and 968 nM for recombinant human MAO-A and MAO-B).

| Pack Size | Price | USA Warehouse | Global Warehouse | Quantity |
|---|---|---|---|---|
| 1 mg | $128 | Inquiry | Inquiry | |
| 5 mg | $273 | Inquiry | Inquiry | |
| 10 mg | $393 | Inquiry | Inquiry | |
| 25 mg | $592 | Inquiry | Inquiry | |
| 50 mg | $816 | Inquiry | Inquiry | |
| 100 mg | $1,090 | Inquiry | Inquiry | |
| 200 mg | $1,480 | Inquiry | Inquiry |
| Description | Azure B (Azure B chloride) is a cationic dye and the major metabolite of Methylene blue. Azure B is a selective, and reversible inhibitor of MAO-A (IC50s: 11 and 968 nM for recombinant human MAO-A and MAO-B). |
| Targets&IC50 | MAO-B:968 nM, MAO-A:11 nM |
| In vivo | Azure B (4-30 mg/kg; i.p.; once) reduces immobility in the forced swim test [1]. |
| Cell Research | Instructions 1. Solution configuration 1. Configuration of mother liquor: Use sterile water or PBS to configure MHI-148 into 1-10mM mother liquor and store it at -20℃ or -80℃. Please aliquot it to avoid repeated freeze-thawing. 2. Configuration of working fluid: When in use, dilute the MHI-148 mother liquor into a working fluid that meets the requirements and adjust according to the experimental requirements. 2. Blood smear staining: 1. Prepare an Azure B staining solution, usually by dissolving Azure B chloride in buffer or solvent. 2. Apply the staining solution to the prepared blood smear. 3. Allow the smear to incubate in solution for a few minutes to promote cell staining. 4. Rinse the smear thoroughly with water to remove excess dye and then air dry. 5. Check the stained smear under a microscope and analyze the morphology of blood cells. 3. Monoamine oxidase (MAO) inhibition: 1. Introduce Azure B into in vitro experiments, the inhibitory effect is usually determined using recombinant human MAO-A and MAO-B. 2. The IC50 value at a specific experimental setting can be determined through dose response studies. 3. In addition, the antidepressant effect of Azure B can be evaluated in animal models through behavioral experiments (such as forced swimming experiments, tail suspension experiments). |
| Synonyms | Azure B chloride |
| Molecular Weight | 305.83 |
| Formula | C15H16ClN3S |
| Cas No. | 531-55-5 |
| Smiles | CNC1=CC2=[S+]C3=C(C=CC(N(C)C)=C3)N=C2C=C1.[Cl-] |
| Relative Density. | no data available |
| Color | Black |
| Appearance | solid |
| Storage | keep away from direct sunlight | Powder: -20°C for 3 years | In solvent: -80°C for 1 year | Shipping with blue ice/Shipping at ambient temperature. |
| Solubility Information | DMSO: Insoluble |
| Size | Quantity | Unit Price | Amount | Operation |
|---|

Copyright © 2015-2025 TargetMol Chemicals Inc. All Rights Reserved.