5
Cat No. | Product Name | Synonyms | Targets |
---|---|---|---|
T18479 | NH-bis(C1-Boc) | Others | |
NH-bis(C1-Boc)is a uncleavable linker. NH-bis can be used for antibody-drug conjugates (ADC). | |||
T14849 | C-NH-Boc-C-Bis-(C-PEG1-Boc) | Others | |
C-NH-Boc-C-Bis-(C-PEG1-Boc) is a versatile alkyl/ether-based PROTAC linker for synthesizing PROTACs[1]. | |||
T14850 | C-NH-Boc-C-Bis-(C1-PEG1-PFP) | Others | |
C-NH-Boc-C-Bis-(C1-PEG1-PFP) is a polyethylene glycol (PEG)-derived PROTAC linker, which finds application in the synthesis of PROTACs[1]. | |||
T18480 | NH-bis(C1-PEG1-Boc) | Others | |
NH-bis(C1-PEG1-Boc) is an alkyl/ether-based PROTAC linker utilized for PROTAC synthesis[1]. | |||
T16520 | Ph-Bis(C1-N-(C2-NH-Boc)2) | Others | |
Ph-Bis(C1-N-(C2-NH-Boc)2) is a versatile alkyl chain-derived linker employed in the synthesis of PROTACs[1]. |