2
Cat No. | Product Name | Synonyms | Targets |
---|---|---|---|
T68761 | Cloricromen hydrochloride | Cloricromene hydrochloride,Cloricromen hydrochloride | Others |
Cloricromen hydrochloride, also known as Cloricromene hydrochloride, is a compound that functions as a platelet aggregation inhibitor, effectively preventing platelet aggregation in both humans and experimental thrombosi... | |||
T23899 | Cloricromen | O=C(OCC)COC1=CC=C(C(O2)=C1Cl)C(C)=C(CCN(CC)CC)C2=O | Others |
Cloricromen is an inhibitor of platelet aggregation. |