Shopping Cart
Remove All
Your shopping cart is currently empty
Cy3 (Sulfo-Cyanine3) is an orange-fluorescent label for nucleic acids and proteins (λex=554, λem=568).

| Pack Size | Price | USA Warehouse | Global Warehouse | Quantity |
|---|---|---|---|---|
| 1 mg | $56 | In Stock | In Stock | |
| 2 mg | $79 | In Stock | In Stock | |
| 5 mg | $122 | In Stock | In Stock | |
| 10 mg | $172 | In Stock | In Stock | |
| 25 mg | $339 | In Stock | In Stock | |
| 50 mg | $493 | In Stock | In Stock | |
| 1 mL x 10 mM (in DMSO) | $163 | In Stock | In Stock |
| Description | Cy3 (Sulfo-Cyanine3) is an orange-fluorescent label for nucleic acids and proteins (λex=554, λem=568). |
| Cell Research | 1. Protein labeling
Experimental steps: 1. Prepare CY3 dye solution: Dissolve CY3 in an appropriate solvent (such as DMSO or PBS), at a concentration of usually between 1-10 μM. 2. Reaction with antibodies or proteins: Incubate CY3 dye (10 mg/ml) with the target protein or antibody. Incubate normally at room temperature for 30-60 minutes to ensure the dye binds to the target molecule. 3. Purification: Use dialysis or filtration to remove unbound dyes to ensure that only labeled proteins are present in the sample. 4. Fluorescence measurement: Use a fluorescence microscope or spectrophotometer to detect labeled proteins by selecting the appropriate excitation wavelength (λex = 554 nm) and emission wavelength (λem = 568 nm). 2. Nucleic acid labeling Experimental steps: 1. Prepare CY3-labeled probes or primers: Synthesize probes or primers with CY3-labeled, usually using conventional labeling chemistry. 2. Hybridization: Under appropriate reaction conditions, mix the CY3-labeled probe with the target nucleic acid (such as DNA or RNA) and perform a hybridization reaction. 3. Fluorescence imaging: Use a fluorescence microscope or real-time PCR system to select the appropriate wavelength to detect CY3-labeled nucleic acid signals. 3. Double marking experiment: Experimental steps: 1. Label multiple targets: Use CY3 and other fluorescent markers (such as FITC, Cy5, etc.) to label different target molecules separately. 2. Confocal imaging: Observe multiple labeled samples through confocal microscope or multi-channel microscope to perform spatial positioning of target molecules. Notes: 1. Photostability: CY3 dye may experience photobleaching under high-intensity light, so it is necessary to optimize the exposure time and light source intensity of fluorescence imaging experiments. 2. Solubility: CY3 has good solubility, but it is still necessary to avoid excessive concentration of dye solutions when used to prevent non-specific binding. 3. Cell permeability: CY3 has good cell permeability, but in some cases, it may be necessary to optimize experimental conditions, such as using penetrating reagents or performing cell membrane modification. |
| Synonyms | Sulfo-Cyanine3, Cy3 |
| Molecular Weight | 630.78 |
| Formula | C31H38N2O8S2 |
| Cas No. | 146368-13-0 |
| Smiles | C(CCCCC(O)=O)N1C=2C(C(C)(C)C1=CC=CC3=[N+](CC)C=4C(C3(C)C)=CC(S(=O)(=O)[O-])=CC4)=CC(S(=O)(=O)O)=CC2 |
| Relative Density. | no data available |
| Storage | keep away from direct sunlight | Powder: -20°C for 3 years | In solvent: -80°C for 1 year | Shipping with blue ice/Shipping at ambient temperature. | |||||||||||||||||||||||||
| Solubility Information | H2O: 25 mg/mL (39.63 mM), Sonication is recommended. | |||||||||||||||||||||||||
Solution Preparation Table | ||||||||||||||||||||||||||
H2O
| ||||||||||||||||||||||||||
| Size | Quantity | Unit Price | Amount | Operation |
|---|

Copyright © 2015-2025 TargetMol Chemicals Inc. All Rights Reserved.