Shopping Cart
Remove All
Your shopping cart is currently empty
[Glu1]-Fibrinopeptide B, a derivative of fibrinopeptide B amino acid residues 1-14, originates from human fibrinopeptide B (hFpB). hFpB is a proteolytic cleavage product of the fibrinogen B beta-chain, specifically generated by thrombin, which plays a significant role in activating neutrophils (PMN), monocytes, and fibroblasts.
![[Glu1]-Fibrinopeptide B](https://cdn.targetmol.com/group3/M00/3F/19/CgoaEWbZkJeEAwX3AAAAAHY8lhk925.png)
| Pack Size | Price | USA Warehouse | Global Warehouse | Quantity |
|---|---|---|---|---|
| 1 mg | $175 | Inquiry | Inquiry | |
| 5 mg | $711 | Inquiry | Inquiry |
| Description | [Glu1]-Fibrinopeptide B, a derivative of fibrinopeptide B amino acid residues 1-14, originates from human fibrinopeptide B (hFpB). hFpB is a proteolytic cleavage product of the fibrinogen B beta-chain, specifically generated by thrombin, which plays a significant role in activating neutrophils (PMN), monocytes, and fibroblasts. |
| Molecular Weight | 1570.6 |
| Formula | C66H95N19O26 |
| Cas No. | 103213-49-6 |
| Smiles | [C@@H](CC1=CC=CC=C1)(NC([C@H](CC2=CC=CC=C2)NC(CNC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC(CNC([C@H](CCC(O)=O)N)=O)=O)C(C)C)=O)CC(N)=O)=O)CC(O)=O)=O)CC(N)=O)=O)CCC(O)=O)=O)CCC(O)=O)=O)=O)=O)C(N[C@H](C(N[C@H](C(N[C@@H](CCCNC(=N)N)C(O)=O)=O)C)=O)CO)=O |
| Relative Density. | 1.561 g/cm3 |
| Sequence | Glu-Gly-Val-Asn-Asp-Asn-Glu-Glu-Gly-Phe-Phe-Ser-Ala-Arg |
| Sequence Short | EGVNDNEEGFFSAR |
| Storage | keep away from moisture | Powder: -20°C for 3 years | In solvent: -80°C for 1 year | Shipping with blue ice/Shipping at ambient temperature. |
| Solubility Information | H2O: Soluble |
| Size | Quantity | Unit Price | Amount | Operation |
|---|

Copyright © 2015-2026 TargetMol Chemicals Inc. All Rights Reserved.