Shopping Cart
- Remove All
- Your shopping cart is currently empty
Perylene, a polycyclic aromatic hydrocarbon composed of four linearly fused benzene rings, is commonly used as a pigment and dye in various applications, such as printing inks, plastics, and textiles. Additionally, Perylene holds potential as a photosensitizer in solar cells and as a fluorescent probe in biochemistry and materials science. Its rigid planar structure imparts unique electronic and optical properties, making Perylene a versatile and significant compound in numerous fields of chemistry and materials science.
Pack Size | Price | Availability | Quantity |
---|---|---|---|
200 mg | $29 | In Stock |
Description | Perylene, a polycyclic aromatic hydrocarbon composed of four linearly fused benzene rings, is commonly used as a pigment and dye in various applications, such as printing inks, plastics, and textiles. Additionally, Perylene holds potential as a photosensitizer in solar cells and as a fluorescent probe in biochemistry and materials science. Its rigid planar structure imparts unique electronic and optical properties, making Perylene a versatile and significant compound in numerous fields of chemistry and materials science. |
Molecular Weight | 252.3093 |
Formula | C20H12 |
Cas No. | 198-55-0 |
Smiles | C12=CC=CC(C3=CC=CC4=C3C5=CC=C4)=C1C5=CC=C2 |
Storage |
Copyright © 2015-2025 TargetMol Chemicals Inc. All Rights Reserved.