Shopping Cart
Remove All
Your shopping cart is currently empty
BHQ3 Maleimide is a fluorescent probe that eliminates background fluorescence and can be used for protein labeling, nucleic acid labeling and cellular imaging.

| Pack Size | Price | USA Warehouse | Global Warehouse | Quantity |
|---|---|---|---|---|
| 1 mg | $98 | - | In Stock | |
| 2 mg | $142 | - | In Stock | |
| 5 mg | $236 | - | In Stock | |
| 10 mg | $348 | - | In Stock | |
| 25 mg | Preferential | - | In Stock |
| Description | BHQ3 Maleimide is a fluorescent probe that eliminates background fluorescence and can be used for protein labeling, nucleic acid labeling and cellular imaging. |
| Cell Research | Instructions 1. Protein labeling Experimental steps: 1. Prepare a protein solution containing thiol groups to ensure that the protein concentration is suitable for the reaction. 2. Prepare the BHQ3 Maleimide solution, usually dissolved in an appropriate solvent (such as DMSO). 3. Add BHQ3 Maleimide solution to the protein solution, and the reaction time is usually 1-2 hours. 4. After the reaction is completed, use dialysis or other methods to remove the unreacted BHQ3 Maleimide. 5. Fluorescence imaging or quantitative analysis of proteins is performed using a fluorescence microscope or flow cytometry. 2. Nucleic acid labeling Experimental steps: 1. Prepare a nucleic acid probe containing thiol. 2. Add BHQ3 Maleimide solution to the nucleic acid solution, and the reaction time is usually 30 minutes to 1 hour. 3. After the reaction is completed, the unreacted probe is removed by purification. 4. Use the labeled nucleic acid probes for PCR amplification, real-time quantitative PCR and other experiments. 5. Use fluorescent instruments to analyze the nucleic acid labeling results as needed. III. Cell imaging Experimental steps: 1. Prepare the cell sample and fix it (if necessary). 2. Dissolve BHQ3 Maleimide with a suitable solvent. 3. Add BHQ3 Maleimide to the cell culture medium together with the appropriate fluorescent dye. 4. After incubation for a certain period of time, use a fluorescence microscope to observe the fluorescence images of the cells labeled. |
| Molecular Weight | 704.27 |
| Formula | C40H42ClN7O3 |
| Smiles | CCN(c(cc1)cc2c1cc(ccc(/N=N/c3ccc(N(CCCNC(CCN4C(C=CC4=O)=O)=O)C)cc3)c5)c5[n+]2c6ccccc6)CC.[Cl-] |
| Color | Purple |
| Appearance | Solid |
| Storage | store at low temperature | Powder: -20°C for 3 years | In solvent: -80°C for 1 year | Shipping with blue ice/Shipping at ambient temperature. | ||||||||||||||||||||
| Solubility Information | H2O: 12.5 mg/mL (17.75 mM), Sonication is recommended. | ||||||||||||||||||||
Solution Preparation Table | |||||||||||||||||||||
H2O
| |||||||||||||||||||||
| Size | Quantity | Unit Price | Amount | Operation |
|---|

Copyright © 2015-2025 TargetMol Chemicals Inc. All Rights Reserved.