Your shopping cart is currently empty

5,10,15,20-Tetrakis(p-tolyl)porphyrin (TTP) is an organic compound classified within the porphyrin family, characterized by a cyclic structure formed from four pyrrole rings. TTP is a synthetic porphyrin commonly employed as a sensitizer in dye-sensitized solar cells and as a catalyst in various organic reactions. Owing to its unique structure, TTP exhibits a range of intriguing properties, including specific wavelength absorption and potential as a catalyst for different chemical reactions. In dye-sensitized solar cells, TTP aids in converting sunlight into electrical energy by absorbing photons and transferring electrons to the device's semiconductor layer. In organic chemistry, TTP is frequently utilized as a catalyst for reactions such as oxidation and reduction, selectively binding to certain substrates, making it a valuable tool for synthesizing complex molecules and studying their properties.

| Pack Size | Price | USA Warehouse | Global Warehouse | Quantity |
|---|---|---|---|---|
| 5 g | Inquiry | 7-10 days | 7-10 days | |
| 10 g | Inquiry | 7-10 days | 7-10 days | |
| 50 g | Inquiry | 7-10 days | 7-10 days |
| Description | 5,10,15,20-Tetrakis(p-tolyl)porphyrin (TTP) is an organic compound classified within the porphyrin family, characterized by a cyclic structure formed from four pyrrole rings. TTP is a synthetic porphyrin commonly employed as a sensitizer in dye-sensitized solar cells and as a catalyst in various organic reactions. Owing to its unique structure, TTP exhibits a range of intriguing properties, including specific wavelength absorption and potential as a catalyst for different chemical reactions. In dye-sensitized solar cells, TTP aids in converting sunlight into electrical energy by absorbing photons and transferring electrons to the device's semiconductor layer. In organic chemistry, TTP is frequently utilized as a catalyst for reactions such as oxidation and reduction, selectively binding to certain substrates, making it a valuable tool for synthesizing complex molecules and studying their properties. |
| Synonyms | 5,10,15,20-Tetra-p-tolyl-21H,23H-porphine, 5,10,15,20-Tetrakis(p-tolyl)porphyrin |
| Molecular Weight | 670.8421 |
| Formula | C48H38N4 |
| Cas No. | 14527-51-6 |
| Smiles | CC1=CC=C(/C2=C3C=CC(/C(C4=CC=C(C)C=C4)=C(N/5)/C=CC5=C(C6=CC=C(C)C=C6)\C7=N/C(C=C7)=C(C8=CC=C(C)C=C8)\C9=CC=C2N9)=N\3)C=C1 |
| Storage | keep away from direct sunlight,store under nitrogen | store at 4°C |
| Size | Quantity | Unit Price | Amount | Operation |
|---|

Copyright © 2015-2026 TargetMol Chemicals Inc. All Rights Reserved.